C20H17F3O2 — CID 57386566
ethyl (2E,4E)-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoate (PubChem CID 57386566) has the molecular formula C20H17F3O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is ethyl (2E,4E)-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 57386566 |
| Molecular Formula | C20H17F3O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | ethyl (2E,4E)-5-phenyl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C/C=C(\c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3O2/c1-2-25-19(24)10-6-9-18(15-7-4-3-5-8-15)16-11-13-17(14-12-16)20(21,22)23/h3-14H,2H2,1H3/b10-6+,18-9+ |
| InChIKey | JWVYPNOGLKEOLR-YPSCDPQASA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|