C14H12BrF3O2 — CID 90693915
ethyl 5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoate (PubChem CID 90693915) has the molecular formula C14H12BrF3O2 and a molecular weight of 349.15 g/mol. Its IUPAC name is ethyl 5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoate.
| Compound Name | ethyl 5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 90693915 |
| Molecular Formula | C14H12BrF3O2 |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | ethyl 5-bromo-5-[3-(trifluoromethyl)phenyl]penta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=C(Br)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12BrF3O2/c1-2-20-13(19)8-4-7-12(15)10-5-3-6-11(9-10)14(16,17)18/h3-9H,2H2,1H3 |
| InChIKey | QXOSUVKSNZNKRO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|