C13H10F3LiO4 — CID 58277291
lithium (Z)-4-ethoxy-3,4-dioxo-1-[3-(trifluoromethyl)phenyl]but-1-en-1-olate (PubChem CID 58277291) has the molecular formula C13H10F3LiO4 and a molecular weight of 294.15 g/mol. Its IUPAC name is lithium (Z)-4-ethoxy-3,4-dioxo-1-[3-(trifluoromethyl)phenyl]but-1-en-1-olate.
| Compound Name | lithium (Z)-4-ethoxy-3,4-dioxo-1-[3-(trifluoromethyl)phenyl]but-1-en-1-olate |
|---|---|
| PubChem CID | 58277291 |
| Molecular Formula | C13H10F3LiO4 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | lithium (Z)-4-ethoxy-3,4-dioxo-1-[3-(trifluoromethyl)phenyl]but-1-en-1-olate |
| SMILES | CCOC(=O)C(=O)/C=C(\[O-])c1cccc(C(F)(F)F)c1.[Li+] |
| InChI | InChI=1S/C13H11F3O4.Li/c1-2-20-12(19)11(18)7-10(17)8-4-3-5-9(6-8)13(14,15)16;/h3-7,17H,2H2,1H3;/q;+1/p-1/b10-7-; |
| InChIKey | IBTUGURWWHGUCE-VEZAGKLZSA-M |
| XLogP | -1.46 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|