C12H9F2LiO4 — CID 67153480
lithium 1-(2,3-difluorophenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 67153480) has the molecular formula C12H9F2LiO4 and a molecular weight of 262.14 g/mol. Its IUPAC name is lithium 1-(2,3-difluorophenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate.
| Compound Name | lithium 1-(2,3-difluorophenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 67153480 |
| Molecular Formula | C12H9F2LiO4 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | lithium 1-(2,3-difluorophenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | CCOC(=O)C(=O)C=C([O-])c1cccc(F)c1F.[Li+] |
| InChI | InChI=1S/C12H10F2O4.Li/c1-2-18-12(17)10(16)6-9(15)7-4-3-5-8(13)11(7)14;/h3-6,15H,2H2,1H3;/q;+1/p-1 |
| InChIKey | YHNTZVIITSFACU-UHFFFAOYSA-M |
| XLogP | -2.20 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|