C11H10FO3- — CID 164845141
(Z)-3-ethoxy-1-(2-fluorophenyl)-3-oxoprop-1-en-1-olate (PubChem CID 164845141) has the molecular formula C11H10FO3- and a molecular weight of 209.20 g/mol. Its IUPAC name is (Z)-3-ethoxy-1-(2-fluorophenyl)-3-oxoprop-1-en-1-olate.
| Compound Name | (Z)-3-ethoxy-1-(2-fluorophenyl)-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 164845141 |
| Molecular Formula | C11H10FO3- |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (Z)-3-ethoxy-1-(2-fluorophenyl)-3-oxoprop-1-en-1-olate |
| SMILES | CCOC(=O)/C=C(\[O-])c1ccccc1F |
| InChI | InChI=1S/C11H11FO3/c1-2-15-11(14)7-10(13)8-5-3-4-6-9(8)12/h3-7,13H,2H2,1H3/p-1/b10-7- |
| InChIKey | SLNZMHNYVVUDBE-YFHOEESVSA-M |
| XLogP | 1.09 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|