C12H9NNa2O7 — CID 154574459
disodium;2-[(E)-4-ethoxy-1-oxido-3,4-dioxobut-1-enyl]-6-nitrophenolate (PubChem CID 154574459) has the molecular formula C12H9NNa2O7 and a molecular weight of 325.18 g/mol. Its IUPAC name is disodium;2-[(E)-4-ethoxy-1-oxido-3,4-dioxobut-1-enyl]-6-nitrophenolate.
| Compound Name | disodium;2-[(E)-4-ethoxy-1-oxido-3,4-dioxobut-1-enyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 154574459 |
| Molecular Formula | C12H9NNa2O7 |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | disodium;2-[(E)-4-ethoxy-1-oxido-3,4-dioxobut-1-enyl]-6-nitrophenolate |
| SMILES | CCOC(=O)C(=O)/C=C(/[O-])c1cccc([N+](=O)[O-])c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C12H11NO7.2Na/c1-2-20-12(17)10(15)6-9(14)7-4-3-5-8(11(7)16)13(18)19;;/h3-6,14,16H,2H2,1H3;;/q;2*+1/p-2/b9-6+;; |
| InChIKey | HNLGFYPYNLPZAY-SWSRPJROSA-L |
| XLogP | -6.49 |
| TPSA | 132.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | -6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|