About lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate
lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 140670995) has the molecular formula C11H9ClLiNO4
and a molecular weight of 261.59 g/mol. Its IUPAC name is lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate.
Molecular Properties
| Compound Name | lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
| PubChem CID | 140670995 |
| Molecular Formula | C11H9ClLiNO4 |
| Molecular Weight | 261.59 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | CCOC(=O)C(=O)/C=C(\[O-])c1ccnc(Cl)c1.[Li+] |
| InChI | InChI=1S/C11H10ClNO4.Li/c1-2-17-11(16)9(15)6-8(14)7-3-4-13-10(12)5-7;/h3-6,14H,2H2,1H3;/q;+1/p-1/b8-6-; |
| InChIKey | HGQABVJTRUQGCQ-PHZXCRFESA-M |
| XLogP | -2.43 |
| TPSA | 79.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.59 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate?
The IUPAC name of lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate (CID 140670995) is lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate.
What is the SMILES notation for lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate?
The canonical SMILES for lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate is CCOC(=O)C(=O)/C=C(\[O-])c1ccnc(Cl)c1.[Li+].
What is the InChIKey of lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate?
The InChIKey is HGQABVJTRUQGCQ-PHZXCRFESA-M. The full InChI is InChI=1S/C11H10ClNO4.Li/c1-2-17-11(16)9(15)6-8(14)7-3-4-13-10(12)5-7;/h3-6,14H,2H2,1H3;/q;+1/p-1/b8-6-;.
What are the key properties of lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate?
lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate has a molecular weight of 261.59 g/mol, XLogP of -2.43, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (Z)-1-(2-chloro-4-pyridinyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate is sourced from PubChem (CID 140670995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).