C13H12ClNaO4 — CID 158594045
sodium (Z)-1-(4-chloro-3-methylphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 158594045) has the molecular formula C13H12ClNaO4 and a molecular weight of 290.68 g/mol. Its IUPAC name is sodium (Z)-1-(4-chloro-3-methylphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate.
| Compound Name | sodium (Z)-1-(4-chloro-3-methylphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 158594045 |
| Molecular Formula | C13H12ClNaO4 |
| Molecular Weight | 290.68 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | sodium (Z)-1-(4-chloro-3-methylphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | CCOC(=O)C(=O)/C=C(\[O-])c1ccc(Cl)c(C)c1.[Na+] |
| InChI | InChI=1S/C13H13ClO4.Na/c1-3-18-13(17)12(16)7-11(15)9-4-5-10(14)8(2)6-9;/h4-7,15H,3H2,1-2H3;/q;+1/p-1/b11-7-; |
| InChIKey | PJCCQJIAOUTQLF-AJULUCINSA-M |
| XLogP | -1.51 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.68 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|