C13H12BrLiO5 — CID 140670992
lithium (Z)-1-(3-bromo-5-methoxyphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 140670992) has the molecular formula C13H12BrLiO5 and a molecular weight of 335.08 g/mol. Its IUPAC name is lithium (Z)-1-(3-bromo-5-methoxyphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate.
| Compound Name | lithium (Z)-1-(3-bromo-5-methoxyphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 140670992 |
| Molecular Formula | C13H12BrLiO5 |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | lithium (Z)-1-(3-bromo-5-methoxyphenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | CCOC(=O)C(=O)/C=C(\[O-])c1cc(Br)cc(OC)c1.[Li+] |
| InChI | InChI=1S/C13H13BrO5.Li/c1-3-19-13(17)12(16)7-11(15)8-4-9(14)6-10(5-8)18-2;/h4-7,15H,3H2,1-2H3;/q;+1/p-1/b11-7-; |
| InChIKey | RMLRPQIOGQFZSM-AJULUCINSA-M |
| XLogP | -1.70 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|