C12H10F2LiNO5 — CID 140671003
lithium (Z)-1-[5-(difluoromethoxy)-3-pyridinyl]-4-ethoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 140671003) has the molecular formula C12H10F2LiNO5 and a molecular weight of 293.15 g/mol. Its IUPAC name is lithium (Z)-1-[5-(difluoromethoxy)-3-pyridinyl]-4-ethoxy-3,4-dioxobut-1-en-1-olate.
| Compound Name | lithium (Z)-1-[5-(difluoromethoxy)-3-pyridinyl]-4-ethoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 140671003 |
| Molecular Formula | C12H10F2LiNO5 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | lithium (Z)-1-[5-(difluoromethoxy)-3-pyridinyl]-4-ethoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | CCOC(=O)C(=O)/C=C(\[O-])c1cncc(OC(F)F)c1.[Li+] |
| InChI | InChI=1S/C12H11F2NO5.Li/c1-2-19-11(18)10(17)4-9(16)7-3-8(6-15-5-7)20-12(13)14;/h3-6,12,16H,2H2,1H3;/q;+1/p-1/b9-4-; |
| InChIKey | UBWWBPSBFMYAMD-WONROIIJSA-M |
| XLogP | -2.48 |
| TPSA | 88.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|