C13H10F3LiO5- — CID 131735133
Lithium 1-(3-difluoromethoxy-5-fluorophenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 131735133) has the molecular formula C13H10F3LiO5- and a molecular weight of 310.15 g/mol.
| Compound Name | Lithium 1-(3-difluoromethoxy-5-fluorophenyl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 131735133 |
| Molecular Formula | C13H10F3LiO5- |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C(=O)C=C([O-])c1cc(F)cc(OC(F)F)c1.[Li] |
| InChI | InChI=1S/C13H11F3O5.Li/c1-2-20-12(19)11(18)6-10(17)7-3-8(14)5-9(4-7)21-13(15)16;/h3-6,13,17H,2H2,1H3;/p-1 |
| InChIKey | LAFBCIAIRHILEV-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|