C14H10F6O4 — CID 76738963
ethyl 4-[3,5-bis(trifluoromethyl)phenyl]-4-hydroxy-2-oxobut-3-enoate (PubChem CID 76738963) has the molecular formula C14H10F6O4 and a molecular weight of 356.22 g/mol. Its IUPAC name is ethyl 4-[3,5-bis(trifluoromethyl)phenyl]-4-hydroxy-2-oxobut-3-enoate.
| Compound Name | ethyl 4-[3,5-bis(trifluoromethyl)phenyl]-4-hydroxy-2-oxobut-3-enoate |
|---|---|
| PubChem CID | 76738963 |
| Molecular Formula | C14H10F6O4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | ethyl 4-[3,5-bis(trifluoromethyl)phenyl]-4-hydroxy-2-oxobut-3-enoate |
| SMILES | CCOC(=O)C(=O)C=C(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10F6O4/c1-2-24-12(23)11(22)6-10(21)7-3-8(13(15,16)17)5-9(4-7)14(18,19)20/h3-6,21H,2H2,1H3 |
| InChIKey | HHNMXNZJWBTOQM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|