About lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride
lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride (PubChem CID 173049773) has the molecular formula C12H11ClFLiO4
and a molecular weight of 280.61 g/mol. Its IUPAC name is lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride.
Molecular Properties
| Compound Name | lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride |
| PubChem CID | 173049773 |
| Molecular Formula | C12H11ClFLiO4 |
| Molecular Weight | 280.61 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride |
| SMILES | CCOC(=O)C(=O)C=C(O)c1ccc(F)c(Cl)c1.[H-].[Li+] |
| InChI | InChI=1S/C12H10ClFO4.Li.H/c1-2-18-12(17)11(16)6-10(15)7-3-4-9(14)8(13)5-7;;/h3-6,15H,2H2,1H3;;/q;+1;-1 |
| InChIKey | FRHRLALXBBVKAF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.61 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
The IUPAC name of lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride (CID 173049773) is lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride.
What is the SMILES notation for lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
The canonical SMILES for lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride is CCOC(=O)C(=O)C=C(O)c1ccc(F)c(Cl)c1.[H-].[Li+].
What is the InChIKey of lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
The InChIKey is FRHRLALXBBVKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClFO4.Li.H/c1-2-18-12(17)11(16)6-10(15)7-3-4-9(14)8(13)5-7;;/h3-6,15H,2H2,1H3;;/q;+1;-1.
What are the key properties of lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride?
lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride has a molecular weight of 280.61 g/mol, XLogP of -0.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;ethyl 4-(3-chloro-4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoate;hydride is sourced from PubChem (CID 173049773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).