C15H14ClNO6 — CID 98155886
ethyl (2E)-2-carbamoyl-6-(4-chlorophenyl)-3,6-dihydroxy-4-oxohexa-2,5-dienoate (PubChem CID 98155886) has the molecular formula C15H14ClNO6 and a molecular weight of 339.73 g/mol. Its IUPAC name is ethyl (2E)-2-carbamoyl-6-(4-chlorophenyl)-3,6-dihydroxy-4-oxohexa-2,5-dienoate.
| Compound Name | ethyl (2E)-2-carbamoyl-6-(4-chlorophenyl)-3,6-dihydroxy-4-oxohexa-2,5-dienoate |
|---|---|
| PubChem CID | 98155886 |
| Molecular Formula | C15H14ClNO6 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | ethyl (2E)-2-carbamoyl-6-(4-chlorophenyl)-3,6-dihydroxy-4-oxohexa-2,5-dienoate |
| SMILES | CCOC(=O)/C(C(N)=O)=C(/O)C(=O)C=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO6/c1-2-23-15(22)12(14(17)21)13(20)11(19)7-10(18)8-3-5-9(16)6-4-8/h3-7,18,20H,2H2,1H3,(H2,17,21)/b10-7?,13-12+ |
| InChIKey | IKVPYHKJCXECIP-PKLFPXQXSA-N |
| XLogP | 1.67 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|