C12H10ClNO3 — CID 54746652
ethyl 3-(4-chlorophenyl)-2-cyano-3-hydroxyprop-2-enoate (PubChem CID 54746652) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-2-cyano-3-hydroxyprop-2-enoate.
| Compound Name | ethyl 3-(4-chlorophenyl)-2-cyano-3-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 54746652 |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-2-cyano-3-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClNO3/c1-2-17-12(16)10(7-14)11(15)8-3-5-9(13)6-4-8/h3-6,15H,2H2,1H3 |
| InChIKey | YCEGTBKZVZKUMF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|