C18H17N3O2 — CID 4184805
ethyl 3,3-dianilino-2-cyanoprop-2-enoate (PubChem CID 4184805) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 3,3-dianilino-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3,3-dianilino-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4184805 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | ethyl 3,3-dianilino-2-cyanoprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c1-2-23-18(22)16(13-19)17(20-14-9-5-3-6-10-14)21-15-11-7-4-8-12-15/h3-12,20-21H,2H2,1H3 |
| InChIKey | FAKIZFBFFMFLQH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|