ethyl 3,3-dianilino-2-cyanoprop-2-enoate

C18H17N3O2 — CID 4184805

IUPACethyl 3,3-dianilino-2-cyanoprop-2-enoate
SMILESCCOC(=O)C(C#N)=C(Nc1ccccc1)Nc1ccccc1
InChIInChI=1S/C18H17N3O2/c1-2-23-18(22)16(13-19)17(20-14-9-5-3-6-10-14)21-15-11-7-4-8-12-15/h3-12,20-21H,2H2,1H3
InChIKeyFAKIZFBFFMFLQH-UHFFFAOYSA-N
MW307.35 g/mol
LogP3.51
Rot. Bonds6

About ethyl 3,3-dianilino-2-cyanoprop-2-enoate

ethyl 3,3-dianilino-2-cyanoprop-2-enoate (PubChem CID 4184805) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is ethyl 3,3-dianilino-2-cyanoprop-2-enoate.

Molecular Properties

Compound Nameethyl 3,3-dianilino-2-cyanoprop-2-enoate
PubChem CID4184805
Molecular FormulaC18H17N3O2
Molecular Weight307.35 g/mol
Exact Mass307.13
IUPAC Nameethyl 3,3-dianilino-2-cyanoprop-2-enoate
SMILESCCOC(=O)C(C#N)=C(Nc1ccccc1)Nc1ccccc1
InChIInChI=1S/C18H17N3O2/c1-2-23-18(22)16(13-19)17(20-14-9-5-3-6-10-14)21-15-11-7-4-8-12-15/h3-12,20-21H,2H2,1H3
InChIKeyFAKIZFBFFMFLQH-UHFFFAOYSA-N
XLogP3.51
TPSA74.15 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.35
LogP ≤ 53.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethyl 3,3-dianilino-2-cyanoprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,3-dianilino-2-cyanoprop-2-enoate?
The IUPAC name of ethyl 3,3-dianilino-2-cyanoprop-2-enoate (CID 4184805) is ethyl 3,3-dianilino-2-cyanoprop-2-enoate.
What is the SMILES notation for ethyl 3,3-dianilino-2-cyanoprop-2-enoate?
The canonical SMILES for ethyl 3,3-dianilino-2-cyanoprop-2-enoate is CCOC(=O)C(C#N)=C(Nc1ccccc1)Nc1ccccc1.
What is the InChIKey of ethyl 3,3-dianilino-2-cyanoprop-2-enoate?
The InChIKey is FAKIZFBFFMFLQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-2-23-18(22)16(13-19)17(20-14-9-5-3-6-10-14)21-15-11-7-4-8-12-15/h3-12,20-21H,2H2,1H3.
What are the key properties of ethyl 3,3-dianilino-2-cyanoprop-2-enoate?
ethyl 3,3-dianilino-2-cyanoprop-2-enoate has a molecular weight of 307.35 g/mol, XLogP of 3.51, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,3-dianilino-2-cyanoprop-2-enoate is sourced from PubChem (CID 4184805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).