C34H26N2O4 — CID 157233929
2-cyano-3,3-diphenylprop-2-enoic acid;ethyl 2-cyano-3,3-diphenylprop-2-enoate (PubChem CID 157233929) has the molecular formula C34H26N2O4 and a molecular weight of 526.59 g/mol. Its IUPAC name is 2-cyano-3,3-diphenylprop-2-enoic acid;ethyl 2-cyano-3,3-diphenylprop-2-enoate.
| Compound Name | 2-cyano-3,3-diphenylprop-2-enoic acid;ethyl 2-cyano-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 157233929 |
| Molecular Formula | C34H26N2O4 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 2-cyano-3,3-diphenylprop-2-enoic acid;ethyl 2-cyano-3,3-diphenylprop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(c1ccccc1)c1ccccc1.N#CC(C(=O)O)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15NO2.C16H11NO2/c1-2-21-18(20)16(13-19)17(14-9-5-3-6-10-14)15-11-7-4-8-12-15;17-11-14(16(18)19)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h3-12H,2H2,1H3;1-10H,(H,18,19) |
| InChIKey | AUKMOLSMUAJVDO-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|