C24H24N4O4 — CID 175832944
(Z)-3-amino-2-cyano-3-(2-ethylphenyl)prop-2-enoic acid;ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate (PubChem CID 175832944) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is (Z)-3-amino-2-cyano-3-(2-ethylphenyl)prop-2-enoic acid;ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate.
| Compound Name | (Z)-3-amino-2-cyano-3-(2-ethylphenyl)prop-2-enoic acid;ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 175832944 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (Z)-3-amino-2-cyano-3-(2-ethylphenyl)prop-2-enoic acid;ethyl (Z)-3-amino-2-cyano-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C(\N)c1ccccc1.CCc1ccccc1/C(N)=C(\C#N)C(=O)O |
| InChI | InChI=1S/2C12H12N2O2/c1-2-8-5-3-4-6-9(8)11(14)10(7-13)12(15)16;1-2-16-12(15)10(8-13)11(14)9-6-4-3-5-7-9/h3-6H,2,14H2,1H3,(H,15,16);3-7H,2,14H2,1H3/b2*11-10- |
| InChIKey | CWEFWXOBEDMIJY-GOSZYWOMSA-N |
| XLogP | 2.97 |
| TPSA | 163.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|