C42H40N2O5 — CID 102208374
[3-[3-(2-cyano-3,3-diphenylprop-2-enoyl)oxy-2,2-dimethylpropoxy]-2,2-dimethylpropyl] 2-cyano-3,3-diphenylprop-2-enoate (PubChem CID 102208374) has the molecular formula C42H40N2O5 and a molecular weight of 652.79 g/mol. Its IUPAC name is [3-[3-(2-cyano-3,3-diphenylprop-2-enoyl)oxy-2,2-dimethylpropoxy]-2,2-dimethylpropyl] 2-cyano-3,3-diphenylprop-2-enoate.
| Compound Name | [3-[3-(2-cyano-3,3-diphenylprop-2-enoyl)oxy-2,2-dimethylpropoxy]-2,2-dimethylpropyl] 2-cyano-3,3-diphenylprop-2-enoate |
|---|---|
| PubChem CID | 102208374 |
| Molecular Formula | C42H40N2O5 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | [3-[3-(2-cyano-3,3-diphenylprop-2-enoyl)oxy-2,2-dimethylpropoxy]-2,2-dimethylpropyl] 2-cyano-3,3-diphenylprop-2-enoate |
| SMILES | CC(C)(COCC(C)(C)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1)COC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H40N2O5/c1-41(2,29-48-39(45)35(25-43)37(31-17-9-5-10-18-31)32-19-11-6-12-20-32)27-47-28-42(3,4)30-49-40(46)36(26-44)38(33-21-13-7-14-22-33)34-23-15-8-16-24-34/h5-24H,27-30H2,1-4H3 |
| InChIKey | CUWLWGXZVBVSTG-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 109.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|