C24H30N3O+ — CID 90887107
[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]-2,2-dimethylpropyl]-trimethylazanium (PubChem CID 90887107) has the molecular formula C24H30N3O+ and a molecular weight of 376.52 g/mol. Its IUPAC name is [3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]-2,2-dimethylpropyl]-trimethylazanium.
| Compound Name | [3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]-2,2-dimethylpropyl]-trimethylazanium |
|---|---|
| PubChem CID | 90887107 |
| Molecular Formula | C24H30N3O+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | [3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]-2,2-dimethylpropyl]-trimethylazanium |
| SMILES | CC(C)(CNC(=O)C(C#N)=C(c1ccccc1)c1ccccc1)C[N+](C)(C)C |
| InChI | InChI=1S/C24H29N3O/c1-24(2,18-27(3,4)5)17-26-23(28)21(16-25)22(19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15H,17-18H2,1-5H3/p+1 |
| InChIKey | QPSXJAFMPXNXMS-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|