C40H40N5O2+ — CID 70877101
bis[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-dimethylazanium (PubChem CID 70877101) has the molecular formula C40H40N5O2+ and a molecular weight of 622.79 g/mol. Its IUPAC name is bis[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-dimethylazanium.
| Compound Name | bis[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 70877101 |
| Molecular Formula | C40H40N5O2+ |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | bis[3-[(2-cyano-3,3-diphenylprop-2-enoyl)amino]propyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCNC(=O)C(C#N)=C(c1ccccc1)c1ccccc1)CCCNC(=O)C(C#N)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H39N5O2/c1-45(2,27-15-25-43-39(46)35(29-41)37(31-17-7-3-8-18-31)32-19-9-4-10-20-32)28-16-26-44-40(47)36(30-42)38(33-21-11-5-12-22-33)34-23-13-6-14-24-34/h3-14,17-24H,15-16,25-28H2,1-2H3,(H-,43,44,46,47)/p+1 |
| InChIKey | KDYIRJBCTYKPIT-UHFFFAOYSA-O |
| XLogP | 6.13 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|