C19H23Cl2N2O+ — CID 87782672
3-benzamidopropyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium (PubChem CID 87782672) has the molecular formula C19H23Cl2N2O+ and a molecular weight of 366.31 g/mol. Its IUPAC name is 3-benzamidopropyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium.
| Compound Name | 3-benzamidopropyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 87782672 |
| Molecular Formula | C19H23Cl2N2O+ |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-benzamidopropyl-[(3,4-dichlorophenyl)methyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCNC(=O)c1ccccc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2O/c1-23(2,14-15-9-10-17(20)18(21)13-15)12-6-11-22-19(24)16-7-4-3-5-8-16/h3-5,7-10,13H,6,11-12,14H2,1-2H3/p+1 |
| InChIKey | BGPCCIZHUCZXNG-UHFFFAOYSA-O |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|