C23H19Cl2N3O — CID 16975738
N-[2-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16975738) has the molecular formula C23H19Cl2N3O and a molecular weight of 424.33 g/mol. Its IUPAC name is N-[2-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | N-[2-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16975738 |
| Molecular Formula | C23H19Cl2N3O |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[2-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1nc2ccccc2n1Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2N3O/c24-18-11-10-16(14-19(18)25)15-28-21-9-5-4-8-20(21)27-22(28)12-13-26-23(29)17-6-2-1-3-7-17/h1-11,14H,12-13,15H2,(H,26,29) |
| InChIKey | MCPCMCHWECZFPQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |