C22H25Cl2N3O — CID 16981428
N-[3-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide (PubChem CID 16981428) has the molecular formula C22H25Cl2N3O and a molecular weight of 418.37 g/mol. Its IUPAC name is N-[3-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16981428 |
| Molecular Formula | C22H25Cl2N3O |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[3-[1-[(3,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCCc1nc2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N3O/c1-22(2,3)21(28)25-12-6-9-20-26-18-7-4-5-8-19(18)27(20)14-15-10-11-16(23)17(24)13-15/h4-5,7-8,10-11,13H,6,9,12,14H2,1-3H3,(H,25,28) |
| InChIKey | UDWJOKHYSZTQKR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|