C26H35N3O — CID 16988805
N-[5-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide (PubChem CID 16988805) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is N-[5-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16988805 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | N-[5-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(C)c(Cn2c(CCCCCNC(=O)C(C)(C)C)nc3ccccc32)c1 |
| InChI | InChI=1S/C26H35N3O/c1-19-14-15-20(2)21(17-19)18-29-23-12-9-8-11-22(23)28-24(29)13-7-6-10-16-27-25(30)26(3,4)5/h8-9,11-12,14-15,17H,6-7,10,13,16,18H2,1-5H3,(H,27,30) |
| InChIKey | NKOPLUPAIFPLGI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|