C31H37N3O — CID 16989618
2,4-dimethyl-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16989618) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is 2,4-dimethyl-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16989618 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 2,4-dimethyl-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCCCCc2nc3ccccc3n2Cc2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C31H37N3O/c1-21-14-15-26(23(3)17-21)31(35)32-16-10-6-7-13-30-33-28-11-8-9-12-29(28)34(30)20-27-24(4)18-22(2)19-25(27)5/h8-9,11-12,14-15,17-19H,6-7,10,13,16,20H2,1-5H3,(H,32,35) |
| InChIKey | WFVJNVTXKSHRTB-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|