C32H39N3O2 — CID 16993020
2-(2,5-dimethylphenoxy)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16993020) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16993020 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | Cc1cc(C)c(Cn2c(CCCCCNC(=O)COc3cc(C)ccc3C)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C32H39N3O2/c1-22-14-15-24(3)30(19-22)37-21-32(36)33-16-10-6-7-13-31-34-28-11-8-9-12-29(28)35(31)20-27-25(4)17-23(2)18-26(27)5/h8-9,11-12,14-15,17-19H,6-7,10,13,16,20-21H2,1-5H3,(H,33,36) |
| InChIKey | YGRTXXAPEHIDNZ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|