C36H39N3O — CID 16994316
2-(4-phenylphenyl)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16994316) has the molecular formula C36H39N3O and a molecular weight of 529.73 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-phenylphenyl)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16994316 |
| Molecular Formula | C36H39N3O |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 2-(4-phenylphenyl)-N-[5-[1-[(2,4,6-trimethylphenyl)methyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | Cc1cc(C)c(Cn2c(CCCCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C36H39N3O/c1-26-22-27(2)32(28(3)23-26)25-39-34-15-10-9-14-33(34)38-35(39)16-8-5-11-21-37-36(40)24-29-17-19-31(20-18-29)30-12-6-4-7-13-30/h4,6-7,9-10,12-15,17-20,22-23H,5,8,11,16,21,24-25H2,1-3H3,(H,37,40) |
| InChIKey | URKLDNYUSJKYHG-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|