C35H37N3O — CID 16985855
2-(4-phenylphenyl)-N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide (PubChem CID 16985855) has the molecular formula C35H37N3O and a molecular weight of 515.70 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide.
| Compound Name | 2-(4-phenylphenyl)-N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide |
|---|---|
| PubChem CID | 16985855 |
| Molecular Formula | C35H37N3O |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 2-(4-phenylphenyl)-N-[3-[1-[(2,3,5,6-tetramethylphenyl)methyl]benzimidazol-2-yl]propyl]acetamide |
| SMILES | Cc1cc(C)c(C)c(Cn2c(CCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)c1C |
| InChI | InChI=1S/C35H37N3O/c1-24-21-25(2)27(4)31(26(24)3)23-38-33-14-9-8-13-32(33)37-34(38)15-10-20-36-35(39)22-28-16-18-30(19-17-28)29-11-6-5-7-12-29/h5-9,11-14,16-19,21H,10,15,20,22-23H2,1-4H3,(H,36,39) |
| InChIKey | QIWADEBBTJLMKJ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|