C28H29N3O3 — CID 16985981
ethyl 2-[2-[3-[[2-(4-phenylphenyl)acetyl]amino]propyl]benzimidazol-1-yl]acetate (PubChem CID 16985981) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[2-(4-phenylphenyl)acetyl]amino]propyl]benzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[3-[[2-(4-phenylphenyl)acetyl]amino]propyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16985981 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | ethyl 2-[2-[3-[[2-(4-phenylphenyl)acetyl]amino]propyl]benzimidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(CCCNC(=O)Cc2ccc(-c3ccccc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C28H29N3O3/c1-2-34-28(33)20-31-25-12-7-6-11-24(25)30-26(31)13-8-18-29-27(32)19-21-14-16-23(17-15-21)22-9-4-3-5-10-22/h3-7,9-12,14-17H,2,8,13,18-20H2,1H3,(H,29,32) |
| InChIKey | WMQQMFZNZHIGHH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|