C34H42N4O2 — CID 16985986
N-[3-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16985986) has the molecular formula C34H42N4O2 and a molecular weight of 538.74 g/mol. Its IUPAC name is N-[3-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[3-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16985986 |
| Molecular Formula | C34H42N4O2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | N-[3-[1-[2-[di(butan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide |
| SMILES | CCC(C)N(C(=O)Cn1c(CCCNC(=O)Cc2ccc(-c3ccccc3)cc2)nc2ccccc21)C(C)CC |
| InChI | InChI=1S/C34H42N4O2/c1-5-25(3)38(26(4)6-2)34(40)24-37-31-16-11-10-15-30(31)36-32(37)17-12-22-35-33(39)23-27-18-20-29(21-19-27)28-13-8-7-9-14-28/h7-11,13-16,18-21,25-26H,5-6,12,17,22-24H2,1-4H3,(H,35,39) |
| InChIKey | PYZOFDBAYXCQBG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|