C36H38N4O2 — CID 16985985
N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16985985) has the molecular formula C36H38N4O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16985985 |
| Molecular Formula | C36H38N4O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-2-(4-phenylphenyl)acetamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)Cn1c(CCCNC(=O)Cc2ccc(-c3ccccc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C36H38N4O2/c1-27(2)39(25-29-12-5-3-6-13-29)36(42)26-40-33-17-10-9-16-32(33)38-34(40)18-11-23-37-35(41)24-28-19-21-31(22-20-28)30-14-7-4-8-15-30/h3-10,12-17,19-22,27H,11,18,23-26H2,1-2H3,(H,37,41) |
| InChIKey | IXUGDNSICLXXEN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|