C31H34N4O2 — CID 16986216
(Z)-N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide (PubChem CID 16986216) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is (Z)-N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16986216 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (Z)-N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)Cn1c(CCCNC(=O)/C=C\c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C31H34N4O2/c1-24(2)34(22-26-14-7-4-8-15-26)31(37)23-35-28-17-10-9-16-27(28)33-29(35)18-11-21-32-30(36)20-19-25-12-5-3-6-13-25/h3-10,12-17,19-20,24H,11,18,21-23H2,1-2H3,(H,32,36)/b20-19- |
| InChIKey | RTEWHLJHEWVZJR-VXPUYCOJSA-N |
| XLogP | 5.24 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|