C27H25N3O2 — CID 16986215
(Z)-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]-3-phenylprop-2-enamide (PubChem CID 16986215) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (Z)-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16986215 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (Z)-N-[3-(1-phenacylbenzimidazol-2-yl)propyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C\c1ccccc1)NCCCc1nc2ccccc2n1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H25N3O2/c31-25(22-12-5-2-6-13-22)20-30-24-15-8-7-14-23(24)29-26(30)16-9-19-28-27(32)18-17-21-10-3-1-4-11-21/h1-8,10-15,17-18H,9,16,19-20H2,(H,28,32)/b18-17- |
| InChIKey | CMOZGQIQVLGUDF-ZCXUNETKSA-N |
| XLogP | 4.68 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|