C29H36N4O2 — CID 16992812
(E)-N-[5-[1-[2-(azepan-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide (PubChem CID 16992812) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is (E)-N-[5-[1-[2-(azepan-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[5-[1-[2-(azepan-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16992812 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | (E)-N-[5-[1-[2-(azepan-1-yl)-2-oxoethyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCCCCc1nc2ccccc2n1CC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C29H36N4O2/c34-28(19-18-24-13-5-3-6-14-24)30-20-10-4-7-17-27-31-25-15-8-9-16-26(25)33(27)23-29(35)32-21-11-1-2-12-22-32/h3,5-6,8-9,13-16,18-19H,1-2,4,7,10-12,17,20-23H2,(H,30,34)/b19-18+ |
| InChIKey | QMSWMXPVHAORAN-VHEBQXMUSA-N |
| XLogP | 4.98 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|