C30H31N3O — CID 16992718
(E)-3-phenyl-N-[5-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]pentyl]prop-2-enamide (PubChem CID 16992718) has the molecular formula C30H31N3O and a molecular weight of 449.60 g/mol. Its IUPAC name is (E)-3-phenyl-N-[5-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[5-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 16992718 |
| Molecular Formula | C30H31N3O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | (E)-3-phenyl-N-[5-[1-[(E)-3-phenylprop-2-enyl]benzimidazol-2-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCCCCc1nc2ccccc2n1C/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H31N3O/c34-30(22-21-26-15-6-2-7-16-26)31-23-11-3-8-20-29-32-27-18-9-10-19-28(27)33(29)24-12-17-25-13-4-1-5-14-25/h1-2,4-7,9-10,12-19,21-22H,3,8,11,20,23-24H2,(H,31,34)/b17-12+,22-21+ |
| InChIKey | PZFHFJKWJPTWNC-DHLXVRQESA-N |
| XLogP | 6.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|