C28H27Cl2N3O — CID 16992701
(E)-N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide (PubChem CID 16992701) has the molecular formula C28H27Cl2N3O and a molecular weight of 492.45 g/mol. Its IUPAC name is (E)-N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16992701 |
| Molecular Formula | C28H27Cl2N3O |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (E)-N-[5-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]pentyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NCCCCCc1nc2ccccc2n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H27Cl2N3O/c29-23-16-15-22(24(30)19-23)20-33-26-12-7-6-11-25(26)32-27(33)13-5-2-8-18-31-28(34)17-14-21-9-3-1-4-10-21/h1,3-4,6-7,9-12,14-17,19H,2,5,8,13,18,20H2,(H,31,34)/b17-14+ |
| InChIKey | MMGBYBPEQJVSQS-SAPNQHFASA-N |
| XLogP | 6.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|