C24H20Cl3N3O — CID 16984581
4-chloro-N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 16984581) has the molecular formula C24H20Cl3N3O and a molecular weight of 472.80 g/mol. Its IUPAC name is 4-chloro-N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 4-chloro-N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16984581 |
| Molecular Formula | C24H20Cl3N3O |
| Molecular Weight | 472.80 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 4-chloro-N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | O=C(NCCCc1nc2ccccc2n1Cc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20Cl3N3O/c25-18-10-7-16(8-11-18)24(31)28-13-3-6-23-29-21-4-1-2-5-22(21)30(23)15-17-9-12-19(26)14-20(17)27/h1-2,4-5,7-12,14H,3,6,13,15H2,(H,28,31) |
| InChIKey | XRJYXFJBMGXWBU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.80 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|