C26H25Cl2N3O2 — CID 16985537
N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 16985537) has the molecular formula C26H25Cl2N3O2 and a molecular weight of 482.41 g/mol. Its IUPAC name is N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16985537 |
| Molecular Formula | C26H25Cl2N3O2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[3-[1-[(2,4-dichlorophenyl)methyl]benzimidazol-2-yl]propyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCCc2nc3ccccc3n2Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O2/c1-33-21-12-8-18(9-13-21)15-26(32)29-14-4-7-25-30-23-5-2-3-6-24(23)31(25)17-19-10-11-20(27)16-22(19)28/h2-3,5-6,8-13,16H,4,7,14-15,17H2,1H3,(H,29,32) |
| InChIKey | PSJAUWQYOARPOE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|