C28H39N3O2 — CID 16985520
2-(4-methoxyphenyl)-N-[3-(1-nonylbenzimidazol-2-yl)propyl]acetamide (PubChem CID 16985520) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[3-(1-nonylbenzimidazol-2-yl)propyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[3-(1-nonylbenzimidazol-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 16985520 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[3-(1-nonylbenzimidazol-2-yl)propyl]acetamide |
| SMILES | CCCCCCCCCn1c(CCCNC(=O)Cc2ccc(OC)cc2)nc2ccccc21 |
| InChI | InChI=1S/C28H39N3O2/c1-3-4-5-6-7-8-11-21-31-26-14-10-9-13-25(26)30-27(31)15-12-20-29-28(32)22-23-16-18-24(33-2)19-17-23/h9-10,13-14,16-19H,3-8,11-12,15,20-22H2,1-2H3,(H,29,32) |
| InChIKey | ORPCIMFEYBCCFQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|