C31H45N3O3 — CID 16994142
2-(3,4-dimethoxyphenyl)-N-[5-(1-nonylbenzimidazol-2-yl)pentyl]acetamide (PubChem CID 16994142) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-(1-nonylbenzimidazol-2-yl)pentyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-(1-nonylbenzimidazol-2-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 16994142 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-(1-nonylbenzimidazol-2-yl)pentyl]acetamide |
| SMILES | CCCCCCCCCn1c(CCCCCNC(=O)Cc2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C31H45N3O3/c1-4-5-6-7-8-9-15-22-34-27-17-13-12-16-26(27)33-30(34)18-11-10-14-21-32-31(35)24-25-19-20-28(36-2)29(23-25)37-3/h12-13,16-17,19-20,23H,4-11,14-15,18,21-22,24H2,1-3H3,(H,32,35) |
| InChIKey | XIIUYCHCVHRSRC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|