C31H37N3O5 — CID 16994201
2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16994201) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16994201 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | COc1cccc(OCCn2c(CCCCCNC(=O)Cc3ccc(OC)c(OC)c3)nc3ccccc32)c1 |
| InChI | InChI=1S/C31H37N3O5/c1-36-24-10-9-11-25(22-24)39-19-18-34-27-13-7-6-12-26(27)33-30(34)14-5-4-8-17-32-31(35)21-23-15-16-28(37-2)29(20-23)38-3/h6-7,9-13,15-16,20,22H,4-5,8,14,17-19,21H2,1-3H3,(H,32,35) |
| InChIKey | RGGDRNUZTPKBFP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|