C31H36ClN3O4 — CID 16994193
N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 16994193) has the molecular formula C31H36ClN3O4 and a molecular weight of 550.10 g/mol. Its IUPAC name is N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16994193 |
| Molecular Formula | C31H36ClN3O4 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CCOc2ccc(Cl)c(C)c2)cc1OC |
| InChI | InChI=1S/C31H36ClN3O4/c1-22-19-24(13-14-25(22)32)39-18-17-35-27-10-7-6-9-26(27)34-30(35)11-5-4-8-16-33-31(36)21-23-12-15-28(37-2)29(20-23)38-3/h6-7,9-10,12-15,19-20H,4-5,8,11,16-18,21H2,1-3H3,(H,33,36) |
| InChIKey | VYFYFVRRKROAMD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|