C26H34ClN3O2 — CID 16988847
N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide (PubChem CID 16988847) has the molecular formula C26H34ClN3O2 and a molecular weight of 456.03 g/mol. Its IUPAC name is N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16988847 |
| Molecular Formula | C26H34ClN3O2 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-[5-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(OCCn2c(CCCCCNC(=O)C(C)(C)C)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C26H34ClN3O2/c1-19-18-20(13-14-21(19)27)32-17-16-30-23-11-8-7-10-22(23)29-24(30)12-6-5-9-15-28-25(31)26(2,3)4/h7-8,10-11,13-14,18H,5-6,9,12,15-17H2,1-4H3,(H,28,31) |
| InChIKey | NIIZSPWMFIGFBN-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|