C30H33Cl2N3O2 — CID 16989875
2-chloro-N-[5-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16989875) has the molecular formula C30H33Cl2N3O2 and a molecular weight of 538.52 g/mol. Its IUPAC name is 2-chloro-N-[5-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 2-chloro-N-[5-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16989875 |
| Molecular Formula | C30H33Cl2N3O2 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 2-chloro-N-[5-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1cc(OCCCCn2c(CCCCCNC(=O)c3ccccc3Cl)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C30H33Cl2N3O2/c1-22-21-23(16-17-25(22)31)37-20-10-9-19-35-28-14-7-6-13-27(28)34-29(35)15-3-2-8-18-33-30(36)24-11-4-5-12-26(24)32/h4-7,11-14,16-17,21H,2-3,8-10,15,18-20H2,1H3,(H,33,36) |
| InChIKey | MDDJGIZTWMGDNH-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|