C28H29Cl2N3O2 — CID 16982786
2-chloro-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 16982786) has the molecular formula C28H29Cl2N3O2 and a molecular weight of 510.47 g/mol. Its IUPAC name is 2-chloro-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 2-chloro-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16982786 |
| Molecular Formula | C28H29Cl2N3O2 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 2-chloro-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | Cc1cc(OCCCCn2c(CCCNC(=O)c3ccccc3Cl)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C28H29Cl2N3O2/c1-20-19-21(14-15-23(20)29)35-18-7-6-17-33-26-12-5-4-11-25(26)32-27(33)13-8-16-31-28(34)22-9-2-3-10-24(22)30/h2-5,9-12,14-15,19H,6-8,13,16-18H2,1H3,(H,31,34) |
| InChIKey | OFVJPOONXBADKI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|