C25H30ClN3O2 — CID 16987142
(Z)-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide (PubChem CID 16987142) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is (Z)-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide.
| Compound Name | (Z)-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide |
|---|---|
| PubChem CID | 16987142 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (Z)-N-[3-[1-[4-(4-chloro-3-methylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide |
| SMILES | C/C=C\C(=O)NCCCc1nc2ccccc2n1CCCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C25H30ClN3O2/c1-3-9-25(30)27-15-8-12-24-28-22-10-4-5-11-23(22)29(24)16-6-7-17-31-20-13-14-21(26)19(2)18-20/h3-5,9-11,13-14,18H,6-8,12,15-17H2,1-2H3,(H,27,30)/b9-3- |
| InChIKey | PJSDBEZQPCYTBB-OQFOIZHKSA-N |
| XLogP | 5.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|