C26H32ClN3O2 — CID 16987180
(Z)-N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide (PubChem CID 16987180) has the molecular formula C26H32ClN3O2 and a molecular weight of 454.01 g/mol. Its IUPAC name is (Z)-N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide.
| Compound Name | (Z)-N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide |
|---|---|
| PubChem CID | 16987180 |
| Molecular Formula | C26H32ClN3O2 |
| Molecular Weight | 454.01 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | (Z)-N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]but-2-enamide |
| SMILES | C/C=C\C(=O)NCCCc1nc2ccccc2n1CCCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C26H32ClN3O2/c1-4-10-25(31)28-14-9-13-24-29-22-11-5-6-12-23(22)30(24)15-7-8-16-32-21-17-19(2)26(27)20(3)18-21/h4-6,10-12,17-18H,7-9,13-16H2,1-3H3,(H,28,31)/b10-4- |
| InChIKey | HVIRRYNVLMYJLW-WMZJFQQLSA-N |
| XLogP | 5.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.01 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|