C28H38ClN3O2 — CID 16988779
N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide (PubChem CID 16988779) has the molecular formula C28H38ClN3O2 and a molecular weight of 484.08 g/mol. Its IUPAC name is N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide.
| Compound Name | N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 16988779 |
| Molecular Formula | C28H38ClN3O2 |
| Molecular Weight | 484.08 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-methylpropanamide |
| SMILES | Cc1cc(OCCCCn2c(CCCCCNC(=O)C(C)C)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C28H38ClN3O2/c1-20(2)28(33)30-15-9-5-6-14-26-31-24-12-7-8-13-25(24)32(26)16-10-11-17-34-23-18-21(3)27(29)22(4)19-23/h7-8,12-13,18-20H,5-6,9-11,14-17H2,1-4H3,(H,30,33) |
| InChIKey | OOJXQDMVXPPIES-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.08 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|