C29H34ClN3O2S — CID 16994935
N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994935) has the molecular formula C29H34ClN3O2S and a molecular weight of 524.13 g/mol. Its IUPAC name is N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994935 |
| Molecular Formula | C29H34ClN3O2S |
| Molecular Weight | 524.13 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-[5-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(OCCCCn2c(CCCCCNC(=O)c3cccs3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C29H34ClN3O2S/c1-21-19-23(20-22(2)28(21)30)35-17-9-8-16-33-25-12-6-5-11-24(25)32-27(33)14-4-3-7-15-31-29(34)26-13-10-18-36-26/h5-6,10-13,18-20H,3-4,7-9,14-17H2,1-2H3,(H,31,34) |
| InChIKey | XNUNMWSTAGASCL-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.13 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|